C18H25IO3S — CID 66918908
(2R)-1-cyclopentyl-2-(3-iodo-4-methylsulfonylphenyl)-4-methylpentan-3-one (PubChem CID 66918908) has the molecular formula C18H25IO3S and a molecular weight of 448.37 g/mol. Its IUPAC name is (2R)-1-cyclopentyl-2-(3-iodo-4-methylsulfonylphenyl)-4-methylpentan-3-one.
| Compound Name | (2R)-1-cyclopentyl-2-(3-iodo-4-methylsulfonylphenyl)-4-methylpentan-3-one |
|---|---|
| PubChem CID | 66918908 |
| Molecular Formula | C18H25IO3S |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | (2R)-1-cyclopentyl-2-(3-iodo-4-methylsulfonylphenyl)-4-methylpentan-3-one |
| SMILES | CC(C)C(=O)[C@H](CC1CCCC1)c1ccc(S(C)(=O)=O)c(I)c1 |
| InChI | InChI=1S/C18H25IO3S/c1-12(2)18(20)15(10-13-6-4-5-7-13)14-8-9-17(16(19)11-14)23(3,21)22/h8-9,11-13,15H,4-7,10H2,1-3H3/t15-/m1/s1 |
| InChIKey | GVXFROVMQQEFQI-OAHLLOKOSA-N |
| XLogP | 4.58 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|