C15H18F3NO4S — CID 120782359
4-[[2-methyl-4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid (PubChem CID 120782359) has the molecular formula C15H18F3NO4S and a molecular weight of 365.37 g/mol. Its IUPAC name is 4-[[2-methyl-4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-methyl-4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120782359 |
| Molecular Formula | C15H18F3NO4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 4-[[2-methyl-4-(trifluoromethyl)phenyl]sulfonylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(C(F)(F)F)ccc1S(=O)(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H18F3NO4S/c1-9-8-11(15(16,17)18)4-7-13(9)24(22,23)19-12-5-2-10(3-6-12)14(20)21/h4,7-8,10,12,19H,2-3,5-6H2,1H3,(H,20,21) |
| InChIKey | PTSWQOFOZZOTHL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |