C11H16N2O5S2 — CID 63361521
3-N-(oxan-3-yl)benzene-1,3-disulfonamide (PubChem CID 63361521) has the molecular formula C11H16N2O5S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-N-(oxan-3-yl)benzene-1,3-disulfonamide.
| Compound Name | 3-N-(oxan-3-yl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 63361521 |
| Molecular Formula | C11H16N2O5S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3-N-(oxan-3-yl)benzene-1,3-disulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)NC2CCCOC2)c1 |
| InChI | InChI=1S/C11H16N2O5S2/c12-19(14,15)10-4-1-5-11(7-10)20(16,17)13-9-3-2-6-18-8-9/h1,4-5,7,9,13H,2-3,6,8H2,(H2,12,14,15) |
| InChIKey | ZDXRQFBYRJBRBF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |