C12H16N2O3S2 — CID 63361664
4-(oxan-3-ylsulfamoyl)benzenecarbothioamide (PubChem CID 63361664) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-(oxan-3-ylsulfamoyl)benzenecarbothioamide.
| Compound Name | 4-(oxan-3-ylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 63361664 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 4-(oxan-3-ylsulfamoyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)NC2CCCOC2)cc1 |
| InChI | InChI=1S/C12H16N2O3S2/c13-12(18)9-3-5-11(6-4-9)19(15,16)14-10-2-1-7-17-8-10/h3-6,10,14H,1-2,7-8H2,(H2,13,18) |
| InChIKey | XBODHIBLLQLTND-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|