C16H16FNO — CID 116531102
5-fluoro-N-phenylmethoxy-2,3-dihydro-1H-inden-1-amine (PubChem CID 116531102) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is 5-fluoro-N-phenylmethoxy-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-fluoro-N-phenylmethoxy-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 116531102 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 5-fluoro-N-phenylmethoxy-2,3-dihydro-1H-inden-1-amine |
| SMILES | Fc1ccc2c(c1)CCC2NOCc1ccccc1 |
| InChI | InChI=1S/C16H16FNO/c17-14-7-8-15-13(10-14)6-9-16(15)18-19-11-12-4-2-1-3-5-12/h1-5,7-8,10,16,18H,6,9,11H2 |
| InChIKey | HFFBSXSVRZQYAZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|