C15H20FNO — CID 103917688
N-(3-ethoxycyclobutyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine (PubChem CID 103917688) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is N-(3-ethoxycyclobutyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-(3-ethoxycyclobutyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 103917688 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-(3-ethoxycyclobutyl)-5-fluoro-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCOC1CC(NC2CCc3cc(F)ccc32)C1 |
| InChI | InChI=1S/C15H20FNO/c1-2-18-13-8-12(9-13)17-15-6-3-10-7-11(16)4-5-14(10)15/h4-5,7,12-13,15,17H,2-3,6,8-9H2,1H3 |
| InChIKey | ITMPUNXXIZGFMD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |