C13H14N4O — CID 68711694
3-(3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl)benzonitrile (PubChem CID 68711694) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is 3-(3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl)benzonitrile.
| Compound Name | 3-(3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 68711694 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 3-(3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl)benzonitrile |
| SMILES | N#Cc1cccc(N2CC3CNCCN3C2=O)c1 |
| InChI | InChI=1S/C13H14N4O/c14-7-10-2-1-3-11(6-10)17-9-12-8-15-4-5-16(12)13(17)18/h1-3,6,12,15H,4-5,8-9H2 |
| InChIKey | XPDMHMGHPFSLQC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |