C15H19N3 — CID 144537942
3-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-yl)benzonitrile (PubChem CID 144537942) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 3-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-yl)benzonitrile.
| Compound Name | 3-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-yl)benzonitrile |
|---|---|
| PubChem CID | 144537942 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 3-(2,3,4,6,7,8,9,9a-octahydro-1H-pyrido[1,2-a]pyrazin-7-yl)benzonitrile |
| SMILES | N#Cc1cccc(C2CCC3CNCCN3C2)c1 |
| InChI | InChI=1S/C15H19N3/c16-9-12-2-1-3-13(8-12)14-4-5-15-10-17-6-7-18(15)11-14/h1-3,8,14-15,17H,4-7,10-11H2 |
| InChIKey | SMRCMEMRZPVLGU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |