C16H17N3 — CID 69251074
3-[2-[(6R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-6-yl]ethynyl]benzonitrile (PubChem CID 69251074) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[2-[(6R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-6-yl]ethynyl]benzonitrile.
| Compound Name | 3-[2-[(6R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-6-yl]ethynyl]benzonitrile |
|---|---|
| PubChem CID | 69251074 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-[2-[(6R,8aS)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-6-yl]ethynyl]benzonitrile |
| SMILES | N#Cc1cccc(C#C[C@H]2CC[C@H]3CNCCN32)c1 |
| InChI | InChI=1S/C16H17N3/c17-11-14-3-1-2-13(10-14)4-5-15-6-7-16-12-18-8-9-19(15)16/h1-3,10,15-16,18H,6-9,12H2/t15-,16-/m0/s1 |
| InChIKey | NVYHSFRIHZPEQI-HOTGVXAUSA-N |
| XLogP | 1.35 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|