C20H18ClN5 — CID 143411490
3-[(8aS)-6-[2-(3-chlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile (PubChem CID 143411490) has the molecular formula C20H18ClN5 and a molecular weight of 363.85 g/mol. Its IUPAC name is 3-[(8aS)-6-[2-(3-chlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[(8aS)-6-[2-(3-chlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 143411490 |
| Molecular Formula | C20H18ClN5 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-[(8aS)-6-[2-(3-chlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCN2C(C#Cc3cccc(Cl)c3)CC[C@H]2C1 |
| InChI | InChI=1S/C20H18ClN5/c21-16-3-1-2-15(12-16)4-5-17-6-7-18-14-25(10-11-26(17)18)20-19(13-22)23-8-9-24-20/h1-3,8-9,12,17-18H,6-7,10-11,14H2/t17?,18-/m0/s1 |
| InChIKey | XWUPUFNAWAIRIS-ZVAWYAOSSA-N |
| XLogP | 2.71 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|