C19H20N4 — CID 69120548
(6R,8aS)-6-(2-phenylethynyl)-2-pyrazin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 69120548) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is (6R,8aS)-6-(2-phenylethynyl)-2-pyrazin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (6R,8aS)-6-(2-phenylethynyl)-2-pyrazin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 69120548 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (6R,8aS)-6-(2-phenylethynyl)-2-pyrazin-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C(#C[C@H]1CC[C@H]2CN(c3cnccn3)CCN21)c1ccccc1 |
| InChI | InChI=1S/C19H20N4/c1-2-4-16(5-3-1)6-7-17-8-9-18-15-22(12-13-23(17)18)19-14-20-10-11-21-19/h1-5,10-11,14,17-18H,8-9,12-13,15H2/t17-,18-/m0/s1 |
| InChIKey | POAYLKMYPPQAFJ-ROUUACIJSA-N |
| XLogP | 2.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|