C19H17ClN6O2 — CID 58826354
1-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-4-(3-cyanopyrazin-2-yl)piperazine-2-carboxamide (PubChem CID 58826354) has the molecular formula C19H17ClN6O2 and a molecular weight of 396.84 g/mol. Its IUPAC name is 1-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-4-(3-cyanopyrazin-2-yl)piperazine-2-carboxamide.
| Compound Name | 1-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-4-(3-cyanopyrazin-2-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 58826354 |
| Molecular Formula | C19H17ClN6O2 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-4-(3-cyanopyrazin-2-yl)piperazine-2-carboxamide |
| SMILES | N#Cc1nccnc1N1CCN(C(=O)/C=C/c2cccc(Cl)c2)C(C(N)=O)C1 |
| InChI | InChI=1S/C19H17ClN6O2/c20-14-3-1-2-13(10-14)4-5-17(27)26-9-8-25(12-16(26)18(22)28)19-15(11-21)23-6-7-24-19/h1-7,10,16H,8-9,12H2,(H2,22,28)/b5-4+ |
| InChIKey | YBKYYKKOIGNZAB-SNAWJCMRSA-N |
| XLogP | 1.22 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|