C16H19N — CID 132541243
(3R,8aR)-3-(2-phenylethynyl)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 132541243) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is (3R,8aR)-3-(2-phenylethynyl)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (3R,8aR)-3-(2-phenylethynyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 132541243 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (3R,8aR)-3-(2-phenylethynyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C(#C[C@H]1CC[C@H]2CCCCN21)c1ccccc1 |
| InChI | InChI=1S/C16H19N/c1-2-6-14(7-3-1)9-10-16-12-11-15-8-4-5-13-17(15)16/h1-3,6-7,15-16H,4-5,8,11-13H2/t15-,16+/m1/s1 |
| InChIKey | ZMVAHGAENISEMA-CVEARBPZSA-N |
| XLogP | 3.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|