C9H13N — CID 18396254
(3S)-3-ethynyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 18396254) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (3S)-3-ethynyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | (3S)-3-ethynyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 18396254 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (3S)-3-ethynyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | C#C[C@@H]1CCC2CCCN21 |
| InChI | InChI=1S/C9H13N/c1-2-8-5-6-9-4-3-7-10(8)9/h1,8-9H,3-7H2/t8-,9?/m1/s1 |
| InChIKey | YNDOCKQZMRIETO-VEDVMXKPSA-N |
| XLogP | 1.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|