C15H25N — CID 101105437
(5S,9aR)-5-hex-1-ynyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepine (PubChem CID 101105437) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is (5S,9aR)-5-hex-1-ynyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepine.
| Compound Name | (5S,9aR)-5-hex-1-ynyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepine |
|---|---|
| PubChem CID | 101105437 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | (5S,9aR)-5-hex-1-ynyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepine |
| SMILES | CCCCC#C[C@@H]1CCCC[C@@H]2CCCN21 |
| InChI | InChI=1S/C15H25N/c1-2-3-4-5-9-14-10-6-7-11-15-12-8-13-16(14)15/h14-15H,2-4,6-8,10-13H2,1H3/t14-,15-/m1/s1 |
| InChIKey | FAJZSNYVBAAXIO-HUUCEWRRSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|