C12H23N — CID 579931
3-butyl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 579931) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 3-butyl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 3-butyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 579931 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 3-butyl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CCCCC1CCC2CCCCN12 |
| InChI | InChI=1S/C12H23N/c1-2-3-6-11-8-9-12-7-4-5-10-13(11)12/h11-12H,2-10H2,1H3 |
| InChIKey | BRCJXNQWQYCLHP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |