C9H16ClN — CID 139644525
3-(2-chloroethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 139644525) has the molecular formula C9H16ClN and a molecular weight of 173.69 g/mol. Its IUPAC name is 3-(2-chloroethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 3-(2-chloroethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 139644525 |
| Molecular Formula | C9H16ClN |
| Molecular Weight | 173.69 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 3-(2-chloroethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | ClCCC1CCC2CCCN12 |
| InChI | InChI=1S/C9H16ClN/c10-6-5-9-4-3-8-2-1-7-11(8)9/h8-9H,1-7H2 |
| InChIKey | MIFUTFFPIZJWJB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.69 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|