C19H37N — CID 101108976
(3R,5S,9aS)-5-methyl-3-nonyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepine (PubChem CID 101108976) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is (3R,5S,9aS)-5-methyl-3-nonyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepine.
| Compound Name | (3R,5S,9aS)-5-methyl-3-nonyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepine |
|---|---|
| PubChem CID | 101108976 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | (3R,5S,9aS)-5-methyl-3-nonyl-2,3,5,6,7,8,9,9a-octahydro-1H-pyrrolo[1,2-a]azepine |
| SMILES | CCCCCCCCC[C@@H]1CC[C@@H]2CCCC[C@H](C)N12 |
| InChI | InChI=1S/C19H37N/c1-3-4-5-6-7-8-9-13-18-15-16-19-14-11-10-12-17(2)20(18)19/h17-19H,3-16H2,1-2H3/t17-,18+,19-/m0/s1 |
| InChIKey | DQLBFLCLHKVGLT-OTWHNJEPSA-N |
| XLogP | 5.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|