C17H31NO2 — CID 11022346
(3R,5R,8aS)-3-butyl-5-(2-ethyl-1,3-dioxolan-2-yl)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 11022346) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (3R,5R,8aS)-3-butyl-5-(2-ethyl-1,3-dioxolan-2-yl)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (3R,5R,8aS)-3-butyl-5-(2-ethyl-1,3-dioxolan-2-yl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 11022346 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (3R,5R,8aS)-3-butyl-5-(2-ethyl-1,3-dioxolan-2-yl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CCCC[C@@H]1CC[C@@H]2CCC[C@H](C3(CC)OCCO3)N12 |
| InChI | InChI=1S/C17H31NO2/c1-3-5-7-14-10-11-15-8-6-9-16(18(14)15)17(4-2)19-12-13-20-17/h14-16H,3-13H2,1-2H3/t14-,15+,16-/m1/s1 |
| InChIKey | LXAFWTXPTRQLOY-OWCLPIDISA-N |
| XLogP | 3.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |