C20H21N — CID 46177168
1-[(4-methylphenyl)methyl]-2-(2-phenylethynyl)pyrrolidine (PubChem CID 46177168) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-2-(2-phenylethynyl)pyrrolidine.
| Compound Name | 1-[(4-methylphenyl)methyl]-2-(2-phenylethynyl)pyrrolidine |
|---|---|
| PubChem CID | 46177168 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-2-(2-phenylethynyl)pyrrolidine |
| SMILES | Cc1ccc(CN2CCCC2C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N/c1-17-9-11-19(12-10-17)16-21-15-5-8-20(21)14-13-18-6-3-2-4-7-18/h2-4,6-7,9-12,20H,5,8,15-16H2,1H3 |
| InChIKey | YGWWCLOBBYCKPN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|