C40H33NO — CID 100939657
(2R,5R)-1-[(4-methoxyphenyl)methyl]-2,5-bis[2-(4-phenylphenyl)ethynyl]pyrrolidine (PubChem CID 100939657) has the molecular formula C40H33NO and a molecular weight of 543.71 g/mol. Its IUPAC name is (2R,5R)-1-[(4-methoxyphenyl)methyl]-2,5-bis[2-(4-phenylphenyl)ethynyl]pyrrolidine.
| Compound Name | (2R,5R)-1-[(4-methoxyphenyl)methyl]-2,5-bis[2-(4-phenylphenyl)ethynyl]pyrrolidine |
|---|---|
| PubChem CID | 100939657 |
| Molecular Formula | C40H33NO |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (2R,5R)-1-[(4-methoxyphenyl)methyl]-2,5-bis[2-(4-phenylphenyl)ethynyl]pyrrolidine |
| SMILES | COc1ccc(CN2[C@@H](C#Cc3ccc(-c4ccccc4)cc3)CC[C@@H]2C#Cc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C40H33NO/c1-42-40-28-18-33(19-29-40)30-41-38(24-16-31-12-20-36(21-13-31)34-8-4-2-5-9-34)26-27-39(41)25-17-32-14-22-37(23-15-32)35-10-6-3-7-11-35/h2-15,18-23,28-29,38-39H,26-27,30H2,1H3/t38-,39-/m0/s1 |
| InChIKey | ZMPVEZIXASUDLH-YDAXCOIMSA-N |
| XLogP | 8.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|