C26H27NO2 — CID 102519654
4-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]-5-phenyl-3,6-dihydro-2H-pyridine (PubChem CID 102519654) has the molecular formula C26H27NO2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]-5-phenyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]-5-phenyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 102519654 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 4-(4-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]-5-phenyl-3,6-dihydro-2H-pyridine |
| SMILES | COc1ccc(CN2CCC(c3ccc(OC)cc3)=C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C26H27NO2/c1-28-23-12-8-20(9-13-23)18-27-17-16-25(22-10-14-24(29-2)15-11-22)26(19-27)21-6-4-3-5-7-21/h3-15H,16-19H2,1-2H3 |
| InChIKey | LQTSKEFLSSQNAO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|