C16H18N4O — CID 137385727
1-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]cyclopropane-1-carbonitrile (PubChem CID 137385727) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 137385727 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]cyclopropane-1-carbonitrile |
| SMILES | N#CC1(c2ccc(N3C[C@@H]4CNCCN4C3=O)cc2)CC1 |
| InChI | InChI=1S/C16H18N4O/c17-11-16(5-6-16)12-1-3-13(4-2-12)20-10-14-9-18-7-8-19(14)15(20)21/h1-4,14,18H,5-10H2/t14-/m0/s1 |
| InChIKey | WLFVOVIMSSHPFD-AWEZNQCLSA-N |
| XLogP | 1.46 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |