C19H25N3O3 — CID 137385806
1-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]cyclohexane-1-carboxylic acid (PubChem CID 137385806) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 137385806 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-[4-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]phenyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C1N(c2ccc(C3(C(=O)O)CCCCC3)cc2)C[C@@H]2CNCCN12 |
| InChI | InChI=1S/C19H25N3O3/c23-17(24)19(8-2-1-3-9-19)14-4-6-15(7-5-14)22-13-16-12-20-10-11-21(16)18(22)25/h4-7,16,20H,1-3,8-13H2,(H,23,24)/t16-/m0/s1 |
| InChIKey | UYLOJUBHXQNXKH-INIZCTEOSA-N |
| XLogP | 2.19 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |