C12H14N4O3S — CID 138559834
(E)-3-[2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-1,3-thiazol-4-yl]prop-2-enoic acid (PubChem CID 138559834) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is (E)-3-[2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-1,3-thiazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-1,3-thiazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 138559834 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (E)-3-[2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-1,3-thiazol-4-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1csc(N2C[C@@H]3CNCCN3C2=O)n1 |
| InChI | InChI=1S/C12H14N4O3S/c17-10(18)2-1-8-7-20-11(14-8)16-6-9-5-13-3-4-15(9)12(16)19/h1-2,7,9,13H,3-6H2,(H,17,18)/b2-1+/t9-/m0/s1 |
| InChIKey | MYXVJEHLLLIOLG-VWCDRPFISA-N |
| XLogP | 0.45 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|