C19H22N4O3S — CID 137385712
2-[4-[2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-1,3-thiazol-4-yl]phenyl]-2-methylpropanoic acid (PubChem CID 137385712) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-[4-[2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-1,3-thiazol-4-yl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-1,3-thiazol-4-yl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 137385712 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[4-[2-[(8aS)-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyrazin-2-yl]-1,3-thiazol-4-yl]phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1ccc(-c2csc(N3C[C@@H]4CNCCN4C3=O)n2)cc1 |
| InChI | InChI=1S/C19H22N4O3S/c1-19(2,16(24)25)13-5-3-12(4-6-13)15-11-27-17(21-15)23-10-14-9-20-7-8-22(14)18(23)26/h3-6,11,14,20H,7-10H2,1-2H3,(H,24,25)/t14-/m0/s1 |
| InChIKey | TTXTZQKZZBKDAT-AWEZNQCLSA-N |
| XLogP | 2.39 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |