C16H19N5O4 — CID 170727346
N-(2,6-dioxopiperidin-3-yl)-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide (PubChem CID 170727346) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
|---|---|
| PubChem CID | 170727346 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-8-oxa-1,6,12-triazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene-5-carboxamide |
| SMILES | O=C1CCC(NC(=O)c2ccc3c(n2)OCC2CNCCN32)C(=O)N1 |
| InChI | InChI=1S/C16H19N5O4/c22-13-4-2-10(15(24)20-13)18-14(23)11-1-3-12-16(19-11)25-8-9-7-17-5-6-21(9)12/h1,3,9-10,17H,2,4-8H2,(H,18,23)(H,20,22,24) |
| InChIKey | FGWYTADCEDVOIX-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|