C18H20N4O6 — CID 170172308
6-[[(3S)-2,6-dioxopiperidin-3-yl]carbamoyl]spiro[2H-furo[2,3-b]pyridine-3,4'-piperidine]-1'-carboxylic acid (PubChem CID 170172308) has the molecular formula C18H20N4O6 and a molecular weight of 388.38 g/mol. Its IUPAC name is 6-[[(3S)-2,6-dioxopiperidin-3-yl]carbamoyl]spiro[2H-furo[2,3-b]pyridine-3,4'-piperidine]-1'-carboxylic acid.
| Compound Name | 6-[[(3S)-2,6-dioxopiperidin-3-yl]carbamoyl]spiro[2H-furo[2,3-b]pyridine-3,4'-piperidine]-1'-carboxylic acid |
|---|---|
| PubChem CID | 170172308 |
| Molecular Formula | C18H20N4O6 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 6-[[(3S)-2,6-dioxopiperidin-3-yl]carbamoyl]spiro[2H-furo[2,3-b]pyridine-3,4'-piperidine]-1'-carboxylic acid |
| SMILES | O=C1CC[C@H](NC(=O)c2ccc3c(n2)OCC32CCN(C(=O)O)CC2)C(=O)N1 |
| InChI | InChI=1S/C18H20N4O6/c23-13-4-3-11(15(25)21-13)19-14(24)12-2-1-10-16(20-12)28-9-18(10)5-7-22(8-6-18)17(26)27/h1-2,11H,3-9H2,(H,19,24)(H,26,27)(H,21,23,25)/t11-/m0/s1 |
| InChIKey | POLQQIZHTLGICE-NSHDSACASA-N |
| XLogP | 0.02 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|