C16H23NO3 — CID 169467402
tert-butyl N-[3-(4-methoxy-3-methylphenyl)prop-2-enyl]carbamate (PubChem CID 169467402) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is tert-butyl N-[3-(4-methoxy-3-methylphenyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-methoxy-3-methylphenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169467402 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | tert-butyl N-[3-(4-methoxy-3-methylphenyl)prop-2-enyl]carbamate |
| SMILES | COc1ccc(C=CCNC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C16H23NO3/c1-12-11-13(8-9-14(12)19-5)7-6-10-17-15(18)20-16(2,3)4/h6-9,11H,10H2,1-5H3,(H,17,18) |
| InChIKey | FVPDNJPNQNKDFC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |