C13H12BrClO3S — CID 79596576
(4-bromothiophen-3-yl)-(2-chloro-3,4-dimethoxyphenyl)methanol (PubChem CID 79596576) has the molecular formula C13H12BrClO3S and a molecular weight of 363.66 g/mol. Its IUPAC name is (4-bromothiophen-3-yl)-(2-chloro-3,4-dimethoxyphenyl)methanol.
| Compound Name | (4-bromothiophen-3-yl)-(2-chloro-3,4-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 79596576 |
| Molecular Formula | C13H12BrClO3S |
| Molecular Weight | 363.66 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | (4-bromothiophen-3-yl)-(2-chloro-3,4-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2cscc2Br)c(Cl)c1OC |
| InChI | InChI=1S/C13H12BrClO3S/c1-17-10-4-3-7(11(15)13(10)18-2)12(16)8-5-19-6-9(8)14/h3-6,12,16H,1-2H3 |
| InChIKey | PIFVPCIMFOJOHD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |