About (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol
(2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol (PubChem CID 63895524) has the molecular formula C15H16ClNO3
and a molecular weight of 293.75 g/mol. Its IUPAC name is (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol.
Molecular Properties
| Compound Name | (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol |
| PubChem CID | 63895524 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol |
| SMILES | COc1ccc(C(O)c2ccc(C)nc2)c(Cl)c1OC |
| InChI | InChI=1S/C15H16ClNO3/c1-9-4-5-10(8-17-9)14(18)11-6-7-12(19-2)15(20-3)13(11)16/h4-8,14,18H,1-3H3 |
| InChIKey | SCVHXKLBSSNFAH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol?
The IUPAC name of (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol (CID 63895524) is (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol.
What is the SMILES notation for (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol?
The canonical SMILES for (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol is COc1ccc(C(O)c2ccc(C)nc2)c(Cl)c1OC.
What is the InChIKey of (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol?
The InChIKey is SCVHXKLBSSNFAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16ClNO3/c1-9-4-5-10(8-17-9)14(18)11-6-7-12(19-2)15(20-3)13(11)16/h4-8,14,18H,1-3H3.
What are the key properties of (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol?
(2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol has a molecular weight of 293.75 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol is sourced from PubChem (CID 63895524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).