C15H16ClNO3 — CID 63895524
(2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol (PubChem CID 63895524) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol.
| Compound Name | (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol |
|---|---|
| PubChem CID | 63895524 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (2-chloro-3,4-dimethoxyphenyl)-(6-methyl-3-pyridinyl)methanol |
| SMILES | COc1ccc(C(O)c2ccc(C)nc2)c(Cl)c1OC |
| InChI | InChI=1S/C15H16ClNO3/c1-9-4-5-10(8-17-9)14(18)11-6-7-12(19-2)15(20-3)13(11)16/h4-8,14,18H,1-3H3 |
| InChIKey | SCVHXKLBSSNFAH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |