C12H8BrCl3O2 — CID 106855701
2-bromo-3-[chloro-(2,5-dichloro-4-methoxyphenyl)methyl]furan (PubChem CID 106855701) has the molecular formula C12H8BrCl3O2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 2-bromo-3-[chloro-(2,5-dichloro-4-methoxyphenyl)methyl]furan.
| Compound Name | 2-bromo-3-[chloro-(2,5-dichloro-4-methoxyphenyl)methyl]furan |
|---|---|
| PubChem CID | 106855701 |
| Molecular Formula | C12H8BrCl3O2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 367.88 |
| IUPAC Name | 2-bromo-3-[chloro-(2,5-dichloro-4-methoxyphenyl)methyl]furan |
| SMILES | COc1cc(Cl)c(C(Cl)c2ccoc2Br)cc1Cl |
| InChI | InChI=1S/C12H8BrCl3O2/c1-17-10-5-8(14)7(4-9(10)15)11(16)6-2-3-18-12(6)13/h2-5,11H,1H3 |
| InChIKey | VCPZZPNWXDCEQR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|