C15H17BrClNO3 — CID 106851517
(2-bromofuran-3-yl)-(2-chloro-4,5-diethoxyphenyl)methanamine (PubChem CID 106851517) has the molecular formula C15H17BrClNO3 and a molecular weight of 374.66 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-(2-chloro-4,5-diethoxyphenyl)methanamine.
| Compound Name | (2-bromofuran-3-yl)-(2-chloro-4,5-diethoxyphenyl)methanamine |
|---|---|
| PubChem CID | 106851517 |
| Molecular Formula | C15H17BrClNO3 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | (2-bromofuran-3-yl)-(2-chloro-4,5-diethoxyphenyl)methanamine |
| SMILES | CCOc1cc(Cl)c(C(N)c2ccoc2Br)cc1OCC |
| InChI | InChI=1S/C15H17BrClNO3/c1-3-19-12-7-10(11(17)8-13(12)20-4-2)14(18)9-5-6-21-15(9)16/h5-8,14H,3-4,18H2,1-2H3 |
| InChIKey | AQZZOEBGDLKYDI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |