C14H11Br2Cl2NO — CID 114369246
(2,5-dibromophenyl)-(2,5-dichloro-4-methoxyphenyl)methanamine (PubChem CID 114369246) has the molecular formula C14H11Br2Cl2NO and a molecular weight of 439.96 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(2,5-dichloro-4-methoxyphenyl)methanamine.
| Compound Name | (2,5-dibromophenyl)-(2,5-dichloro-4-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 114369246 |
| Molecular Formula | C14H11Br2Cl2NO |
| Molecular Weight | 439.96 g/mol |
| Exact Mass | 436.86 |
| IUPAC Name | (2,5-dibromophenyl)-(2,5-dichloro-4-methoxyphenyl)methanamine |
| SMILES | COc1cc(Cl)c(C(N)c2cc(Br)ccc2Br)cc1Cl |
| InChI | InChI=1S/C14H11Br2Cl2NO/c1-20-13-6-11(17)9(5-12(13)18)14(19)8-4-7(15)2-3-10(8)16/h2-6,14H,19H2,1H3 |
| InChIKey | DQULOKFZNLQUHN-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.96 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |