C14H9BrCl3FO — CID 107959110
1-[(3-bromo-2-fluorophenyl)-chloromethyl]-2,5-dichloro-4-methoxybenzene (PubChem CID 107959110) has the molecular formula C14H9BrCl3FO and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-[(3-bromo-2-fluorophenyl)-chloromethyl]-2,5-dichloro-4-methoxybenzene.
| Compound Name | 1-[(3-bromo-2-fluorophenyl)-chloromethyl]-2,5-dichloro-4-methoxybenzene |
|---|---|
| PubChem CID | 107959110 |
| Molecular Formula | C14H9BrCl3FO |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 395.89 |
| IUPAC Name | 1-[(3-bromo-2-fluorophenyl)-chloromethyl]-2,5-dichloro-4-methoxybenzene |
| SMILES | COc1cc(Cl)c(C(Cl)c2cccc(Br)c2F)cc1Cl |
| InChI | InChI=1S/C14H9BrCl3FO/c1-20-12-6-10(16)8(5-11(12)17)13(18)7-3-2-4-9(15)14(7)19/h2-6,13H,1H3 |
| InChIKey | UQGODIOUAOEMAW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|