C17H21ClO — CID 63429398
2-[chloro-(2,3,4,5,6-pentamethylphenyl)methyl]-3-methylfuran (PubChem CID 63429398) has the molecular formula C17H21ClO and a molecular weight of 276.81 g/mol. Its IUPAC name is 2-[chloro-(2,3,4,5,6-pentamethylphenyl)methyl]-3-methylfuran.
| Compound Name | 2-[chloro-(2,3,4,5,6-pentamethylphenyl)methyl]-3-methylfuran |
|---|---|
| PubChem CID | 63429398 |
| Molecular Formula | C17H21ClO |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-[chloro-(2,3,4,5,6-pentamethylphenyl)methyl]-3-methylfuran |
| SMILES | Cc1ccoc1C(Cl)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C17H21ClO/c1-9-7-8-19-17(9)16(18)15-13(5)11(3)10(2)12(4)14(15)6/h7-8,16H,1-6H3 |
| InChIKey | CNVZYZGCTGZOSH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|