C19H24FN — CID 106877511
(4-tert-butylphenyl)-(4-fluoro-2,6-dimethylphenyl)methanamine (PubChem CID 106877511) has the molecular formula C19H24FN and a molecular weight of 285.41 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(4-fluoro-2,6-dimethylphenyl)methanamine.
| Compound Name | (4-tert-butylphenyl)-(4-fluoro-2,6-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 106877511 |
| Molecular Formula | C19H24FN |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (4-tert-butylphenyl)-(4-fluoro-2,6-dimethylphenyl)methanamine |
| SMILES | Cc1cc(F)cc(C)c1C(N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H24FN/c1-12-10-16(20)11-13(2)17(12)18(21)14-6-8-15(9-7-14)19(3,4)5/h6-11,18H,21H2,1-5H3 |
| InChIKey | QBYYNVNKSAIMRF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |