C51H64 — CID 138962496
2,4-bis[bis(4-tert-butylphenyl)methyl]-1,3,5-trimethylbenzene (PubChem CID 138962496) has the molecular formula C51H64 and a molecular weight of 677.07 g/mol. Its IUPAC name is 2,4-bis[bis(4-tert-butylphenyl)methyl]-1,3,5-trimethylbenzene.
| Compound Name | 2,4-bis[bis(4-tert-butylphenyl)methyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 138962496 |
| Molecular Formula | C51H64 |
| Molecular Weight | 677.07 g/mol |
| Exact Mass | 676.50 |
| IUPAC Name | 2,4-bis[bis(4-tert-butylphenyl)methyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)c(C)c1C(c1ccc(C(C)(C)C)cc1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C51H64/c1-33-32-34(2)45(47(38-20-28-42(29-21-38)50(10,11)12)39-22-30-43(31-23-39)51(13,14)15)35(3)44(33)46(36-16-24-40(25-17-36)48(4,5)6)37-18-26-41(27-19-37)49(7,8)9/h16-32,46-47H,1-15H3 |
| InChIKey | BMXSTTZEZYRAHR-UHFFFAOYSA-N |
| XLogP | 14.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.07 |
| LogP ≤ 5 | 14.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|