C18H24N2 — CID 107503111
(4-tert-butylphenyl)-(2,6-dimethyl-4-pyridinyl)methanamine (PubChem CID 107503111) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(2,6-dimethyl-4-pyridinyl)methanamine.
| Compound Name | (4-tert-butylphenyl)-(2,6-dimethyl-4-pyridinyl)methanamine |
|---|---|
| PubChem CID | 107503111 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (4-tert-butylphenyl)-(2,6-dimethyl-4-pyridinyl)methanamine |
| SMILES | Cc1cc(C(N)c2ccc(C(C)(C)C)cc2)cc(C)n1 |
| InChI | InChI=1S/C18H24N2/c1-12-10-15(11-13(2)20-12)17(19)14-6-8-16(9-7-14)18(3,4)5/h6-11,17H,19H2,1-5H3 |
| InChIKey | MHGIIDVFFKMQCS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |