About (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine
(5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine (PubChem CID 43559856) has the molecular formula C17H25N3O
and a molecular weight of 287.41 g/mol. Its IUPAC name is (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine.
Molecular Properties
| Compound Name | (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine |
| PubChem CID | 43559856 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine |
| SMILES | CC(C)(C)c1ccc(C(N)c2noc(C(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C17H25N3O/c1-16(2,3)12-9-7-11(8-10-12)13(18)14-19-15(21-20-14)17(4,5)6/h7-10,13H,18H2,1-6H3 |
| InChIKey | PHGLQTUHOOGKJD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine?
The IUPAC name of (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine (CID 43559856) is (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine.
What is the SMILES notation for (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine?
The canonical SMILES for (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine is CC(C)(C)c1ccc(C(N)c2noc(C(C)(C)C)n2)cc1.
What is the InChIKey of (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine?
The InChIKey is PHGLQTUHOOGKJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3O/c1-16(2,3)12-9-7-11(8-10-12)13(18)14-19-15(21-20-14)17(4,5)6/h7-10,13H,18H2,1-6H3.
What are the key properties of (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine?
(5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine has a molecular weight of 287.41 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-tert-butyl-1,2,4-oxadiazol-3-yl)-(4-tert-butylphenyl)methanamine is sourced from PubChem (CID 43559856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).