C10H7F3IN3O — CID 114283080
(4-iodophenyl)-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methanamine (PubChem CID 114283080) has the molecular formula C10H7F3IN3O and a molecular weight of 369.08 g/mol. Its IUPAC name is (4-iodophenyl)-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methanamine.
| Compound Name | (4-iodophenyl)-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methanamine |
|---|---|
| PubChem CID | 114283080 |
| Molecular Formula | C10H7F3IN3O |
| Molecular Weight | 369.08 g/mol |
| Exact Mass | 368.96 |
| IUPAC Name | (4-iodophenyl)-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]methanamine |
| SMILES | NC(c1ccc(I)cc1)c1noc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H7F3IN3O/c11-10(12,13)9-16-8(17-18-9)7(15)5-1-3-6(14)4-2-5/h1-4,7H,15H2 |
| InChIKey | STAMGWMXQNGDJB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.08 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|