C15H14ClF2N — CID 82818474
4-[1-chloro-1-(2,6-difluoro-3-methylphenyl)propan-2-yl]pyridine (PubChem CID 82818474) has the molecular formula C15H14ClF2N and a molecular weight of 281.73 g/mol. Its IUPAC name is 4-[1-chloro-1-(2,6-difluoro-3-methylphenyl)propan-2-yl]pyridine.
| Compound Name | 4-[1-chloro-1-(2,6-difluoro-3-methylphenyl)propan-2-yl]pyridine |
|---|---|
| PubChem CID | 82818474 |
| Molecular Formula | C15H14ClF2N |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-[1-chloro-1-(2,6-difluoro-3-methylphenyl)propan-2-yl]pyridine |
| SMILES | Cc1ccc(F)c(C(Cl)C(C)c2ccncc2)c1F |
| InChI | InChI=1S/C15H14ClF2N/c1-9-3-4-12(17)13(15(9)18)14(16)10(2)11-5-7-19-8-6-11/h3-8,10,14H,1-2H3 |
| InChIKey | JGRRNAAHGOXPNB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|