C16H18ClN — CID 66458948
4-[1-chloro-1-(2,5-dimethylphenyl)propan-2-yl]pyridine (PubChem CID 66458948) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is 4-[1-chloro-1-(2,5-dimethylphenyl)propan-2-yl]pyridine.
| Compound Name | 4-[1-chloro-1-(2,5-dimethylphenyl)propan-2-yl]pyridine |
|---|---|
| PubChem CID | 66458948 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-[1-chloro-1-(2,5-dimethylphenyl)propan-2-yl]pyridine |
| SMILES | Cc1ccc(C)c(C(Cl)C(C)c2ccncc2)c1 |
| InChI | InChI=1S/C16H18ClN/c1-11-4-5-12(2)15(10-11)16(17)13(3)14-6-8-18-9-7-14/h4-10,13,16H,1-3H3 |
| InChIKey | KHYCDVPFXGQTAT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|