C11H5Cl2F2IS — CID 107477290
4-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-2-iodothiophene (PubChem CID 107477290) has the molecular formula C11H5Cl2F2IS and a molecular weight of 405.03 g/mol. Its IUPAC name is 4-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-2-iodothiophene.
| Compound Name | 4-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-2-iodothiophene |
|---|---|
| PubChem CID | 107477290 |
| Molecular Formula | C11H5Cl2F2IS |
| Molecular Weight | 405.03 g/mol |
| Exact Mass | 403.85 |
| IUPAC Name | 4-[chloro-(2-chloro-4,5-difluorophenyl)methyl]-2-iodothiophene |
| SMILES | Fc1cc(Cl)c(C(Cl)c2csc(I)c2)cc1F |
| InChI | InChI=1S/C11H5Cl2F2IS/c12-7-3-9(15)8(14)2-6(7)11(13)5-1-10(16)17-4-5/h1-4,11H |
| InChIKey | LNUYLDDQCOBWRX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.03 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|