C14H11Cl2IO2S — CID 79684548
7-chloro-8-[chloro-(5-iodothiophen-3-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 79684548) has the molecular formula C14H11Cl2IO2S and a molecular weight of 441.12 g/mol. Its IUPAC name is 7-chloro-8-[chloro-(5-iodothiophen-3-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 7-chloro-8-[chloro-(5-iodothiophen-3-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 79684548 |
| Molecular Formula | C14H11Cl2IO2S |
| Molecular Weight | 441.12 g/mol |
| Exact Mass | 439.89 |
| IUPAC Name | 7-chloro-8-[chloro-(5-iodothiophen-3-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | Clc1cc2c(cc1C(Cl)c1csc(I)c1)OCCCO2 |
| InChI | InChI=1S/C14H11Cl2IO2S/c15-10-6-12-11(18-2-1-3-19-12)5-9(10)14(16)8-4-13(17)20-7-8/h4-7,14H,1-3H2 |
| InChIKey | NMRHKCGDBKXYJF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.12 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|