C10H12ClNO3 — CID 115194384
N-(2,4-dimethoxy-3-methylphenyl)carbamoyl chloride (PubChem CID 115194384) has the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. Its IUPAC name is N-(2,4-dimethoxy-3-methylphenyl)carbamoyl chloride.
| Compound Name | N-(2,4-dimethoxy-3-methylphenyl)carbamoyl chloride |
|---|---|
| PubChem CID | 115194384 |
| Molecular Formula | C10H12ClNO3 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | N-(2,4-dimethoxy-3-methylphenyl)carbamoyl chloride |
| SMILES | COc1ccc(NC(=O)Cl)c(OC)c1C |
| InChI | InChI=1S/C10H12ClNO3/c1-6-8(14-2)5-4-7(9(6)15-3)12-10(11)13/h4-5H,1-3H3,(H,12,13) |
| InChIKey | OKDYKVHMPNYJLF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|