C13H19NO4 — CID 115218452
4-(2,4-dimethoxy-3-methylanilino)butanoic acid (PubChem CID 115218452) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(2,4-dimethoxy-3-methylanilino)butanoic acid.
| Compound Name | 4-(2,4-dimethoxy-3-methylanilino)butanoic acid |
|---|---|
| PubChem CID | 115218452 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-(2,4-dimethoxy-3-methylanilino)butanoic acid |
| SMILES | COc1ccc(NCCCC(=O)O)c(OC)c1C |
| InChI | InChI=1S/C13H19NO4/c1-9-11(17-2)7-6-10(13(9)18-3)14-8-4-5-12(15)16/h6-7,14H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | ADQGTQYVSYFEBV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|