C15H23NO3 — CID 115221019
4-(4-methoxy-2,3-dimethylanilino)-2,2-dimethylbutanoic acid (PubChem CID 115221019) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 4-(4-methoxy-2,3-dimethylanilino)-2,2-dimethylbutanoic acid.
| Compound Name | 4-(4-methoxy-2,3-dimethylanilino)-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 115221019 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 4-(4-methoxy-2,3-dimethylanilino)-2,2-dimethylbutanoic acid |
| SMILES | COc1ccc(NCCC(C)(C)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C15H23NO3/c1-10-11(2)13(19-5)7-6-12(10)16-9-8-15(3,4)14(17)18/h6-7,16H,8-9H2,1-5H3,(H,17,18) |
| InChIKey | AGNICMXPQVRXPU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|