C14H21NO4 — CID 115220535
4-(2,4-dimethoxy-3-methylanilino)-2-methylbutanoic acid (PubChem CID 115220535) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-(2,4-dimethoxy-3-methylanilino)-2-methylbutanoic acid.
| Compound Name | 4-(2,4-dimethoxy-3-methylanilino)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 115220535 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-(2,4-dimethoxy-3-methylanilino)-2-methylbutanoic acid |
| SMILES | COc1ccc(NCCC(C)C(=O)O)c(OC)c1C |
| InChI | InChI=1S/C14H21NO4/c1-9(14(16)17)7-8-15-11-5-6-12(18-3)10(2)13(11)19-4/h5-6,9,15H,7-8H2,1-4H3,(H,16,17) |
| InChIKey | XZDBQYSOIKWNOT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|