C12H16BrNO3 — CID 115220506
4-(3-bromo-4-methoxyanilino)-2-methylbutanoic acid (PubChem CID 115220506) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is 4-(3-bromo-4-methoxyanilino)-2-methylbutanoic acid.
| Compound Name | 4-(3-bromo-4-methoxyanilino)-2-methylbutanoic acid |
|---|---|
| PubChem CID | 115220506 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 4-(3-bromo-4-methoxyanilino)-2-methylbutanoic acid |
| SMILES | COc1ccc(NCCC(C)C(=O)O)cc1Br |
| InChI | InChI=1S/C12H16BrNO3/c1-8(12(15)16)5-6-14-9-3-4-11(17-2)10(13)7-9/h3-4,7-8,14H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | MILDMTDNZUNXGO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|